CAS 898781-00-5

1-Propanone, 1-(2,4-dichlorophenyl)-3-(3,5-dimethylphenyl)-

Description:

1-Propanone, 1-(2,4-dichlorophenyl)-3-(3,5-dimethylphenyl)-, also known by its CAS number 898781-00-5, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with two distinct aromatic substituents: a dichlorophenyl group and a dimethylphenyl group. The presence of chlorine atoms in the dichlorophenyl moiety contributes to its chemical reactivity and potential biological activity. The dimethylphenyl group adds to the compound's hydrophobic characteristics, influencing its solubility and interaction with biological systems. Typically, compounds of this nature may exhibit properties such as moderate volatility and potential applications in pharmaceuticals or agrochemicals, depending on their specific structural attributes. The compound's molecular structure suggests it may participate in various chemical reactions, including electrophilic aromatic substitution or nucleophilic addition, making it of interest in synthetic organic chemistry. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or environmental impact.

Formula: C₁₇H₁₆Cl₂O

InChI: InChI=1S/C17H16Cl2O/c1-11-7-12(2)9-13(8-11)3-6-17(20)15-5-4-14(18)10-16(15)19/h4-5,7-10H,3,6H2,1-2H3

InChI key: InChIKey=HJEMZXKTLAQLQE-UHFFFAOYSA-N

SMILES: C(CC(=O)C1=C(Cl)C=C(Cl)C=C1)C2=CC(C)=CC(C)=C2

Synonyms:

• 1-Propanone, 1-(2,4-dichlorophenyl)-3-(3,5-dimethylphenyl)-
• 1-(2,4-Dichlorophenyl)-3-(3,5-dimethylphenyl)-1-propanone
• 2′,4′-Dichloro-3-(3,5-dimethylphenyl)propiophenone