CymitQuimica logo

CAS 898781-01-6

:

1-Propanone, 1,3-bis[4-(methylthio)phenyl]-

Description:
1-Propanone, 1,3-bis[4-(methylthio)phenyl]- is an organic compound characterized by its ketone functional group and a structure that includes two para-substituted phenyl rings, each containing a methylthio group. This compound typically exhibits a relatively high molecular weight and is likely to be a solid at room temperature, given the presence of multiple aromatic rings which contribute to its stability and melting point. The methylthio groups enhance its solubility in organic solvents and may influence its reactivity, particularly in electrophilic substitution reactions. Additionally, the compound may display interesting electronic properties due to the conjugation between the aromatic systems and the carbonyl group, potentially making it useful in applications such as organic electronics or as a precursor in synthetic chemistry. Safety data should be consulted for handling, as compounds with similar structures can exhibit varying degrees of toxicity or environmental impact. Overall, 1-Propanone, 1,3-bis[4-(methylthio)phenyl]- is a notable compound in the realm of organic synthesis and materials science.
Formula:C17H18OS2
InChI:InChI=1S/C17H18OS2/c1-19-15-8-3-13(4-9-15)5-12-17(18)14-6-10-16(20-2)11-7-14/h3-4,6-11H,5,12H2,1-2H3
InChI key:InChIKey=NVKJIXLJQWBJTN-UHFFFAOYSA-N
SMILES:C(CCC1=CC=C(SC)C=C1)(=O)C2=CC=C(SC)C=C2
Synonyms:
  • 1,3-Bis[4-(methylsulfanyl)phenyl]-1-propanone
  • 1-Propanone, 1,3-bis[4-(methylthio)phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.