CAS 898781-02-7
:1-(2,5-dichlorophenyl)-3-(3,5-dimethylphenyl)propan-1-one
Description:
1-(2,5-Dichlorophenyl)-3-(3,5-dimethylphenyl)propan-1-one, identified by its CAS number 898781-02-7, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with two distinct aromatic substituents: a dichlorophenyl group and a dimethylphenyl group. The presence of chlorine atoms on the phenyl ring contributes to its potential reactivity and influences its physical properties, such as solubility and boiling point. The dimethyl groups on the other phenyl ring can affect steric hindrance and electronic distribution, impacting the compound's overall stability and reactivity. Typically, compounds of this nature may exhibit biological activity, making them of interest in pharmaceutical research. Additionally, the compound's molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity and environmental impact.
Formula:C17H16Cl2O
InChI:InChI=1/C17H16Cl2O/c1-11-7-12(2)9-13(8-11)3-6-17(20)15-10-14(18)4-5-16(15)19/h4-5,7-10H,3,6H2,1-2H3
SMILES:Cc1cc(C)cc(CCC(=O)c2cc(ccc2Cl)Cl)c1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.