CAS 898781-12-9

1-(4-chlorophenyl)-3-(4-methylsulfanylphenyl)propan-1-one

Description:

1-(4-chlorophenyl)-3-(4-methylsulfanylphenyl)propan-1-one, also known by its CAS number 898781-12-9, is an organic compound characterized by its ketone functional group. It features a propanone backbone with two aromatic substituents: a 4-chlorophenyl group and a 4-methylsulfanylphenyl group. The presence of the chlorine atom introduces electronegative characteristics, potentially influencing the compound's reactivity and solubility. The methylsulfanyl group contributes to the compound's overall hydrophobicity and may affect its biological activity. This compound is typically synthesized through organic reactions involving the appropriate precursors and may be of interest in medicinal chemistry due to its structural features. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the compound. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards. Further studies would be necessary to fully elucidate its potential applications and biological effects.

Formula: C₁₆H₁₅ClOS

InChI: InChI=1/C16H15ClOS/c1-19-15-9-2-12(3-10-15)4-11-16(18)13-5-7-14(17)8-6-13/h2-3,5-10H,4,11H2,1H3

SMILES: CSc1ccc(cc1)CCC(=O)c1ccc(cc1)Cl