CymitQuimica logo

CAS 898781-15-2

:

1-(3-fluorophenyl)-3-(4-methylsulfanylphenyl)propan-1-one

Description:
1-(3-fluorophenyl)-3-(4-methylsulfanylphenyl)propan-1-one, with the CAS number 898781-15-2, is an organic compound that belongs to the class of ketones. It features a propanone backbone substituted with a 3-fluorophenyl group and a 4-methylsulfanylphenyl group. The presence of the fluorine atom introduces unique electronic properties, potentially enhancing the compound's reactivity and influencing its interactions with biological targets. The methylsulfanyl group contributes to the compound's overall hydrophobic character, which may affect its solubility and permeability in biological systems. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry and drug development. Its structural complexity suggests potential applications in various fields, including materials science and organic synthesis. However, specific physical properties such as melting point, boiling point, and solubility would need to be determined experimentally or sourced from reliable databases for practical applications.
Formula:C16H15FOS
InChI:InChI=1/C16H15FOS/c1-19-15-8-5-12(6-9-15)7-10-16(18)13-3-2-4-14(17)11-13/h2-6,8-9,11H,7,10H2,1H3
SMILES:CSc1ccc(cc1)CCC(=O)c1cccc(c1)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.