CymitQuimica logo

CAS 898781-24-3

:

1-(2,4-dimethylphenyl)-3-(4-methylsulfanylphenyl)propan-1-one

Description:
1-(2,4-Dimethylphenyl)-3-(4-methylsulfanylphenyl)propan-1-one, with the CAS number 898781-24-3, is an organic compound that belongs to the class of ketones. It features a propanone backbone substituted with two distinct aromatic groups: one containing a dimethyl-substituted phenyl ring and the other a methylthio-substituted phenyl ring. This compound is characterized by its relatively complex structure, which contributes to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the methylthio group can influence its reactivity and interaction with other chemical species, potentially enhancing its biological activity or altering its electronic properties. As with many organic compounds, it is important to handle it with care, considering safety protocols due to potential toxicity or reactivity. Its applications may span various fields, including pharmaceuticals, agrochemicals, or materials science, depending on its specific properties and reactivity.
Formula:C18H20OS
InChI:InChI=1/C18H20OS/c1-13-4-10-17(14(2)12-13)18(19)11-7-15-5-8-16(20-3)9-6-15/h4-6,8-10,12H,7,11H2,1-3H3
SMILES:Cc1ccc(c(C)c1)C(=O)CCc1ccc(cc1)SC
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.