CAS 898781-28-7
:1-Cyclobutyl-3-(3,5-dimethylphenyl)-1-propanone
Description:
1-Cyclobutyl-3-(3,5-dimethylphenyl)-1-propanone, with the CAS number 898781-28-7, is an organic compound characterized by its ketone functional group. It features a cyclobutyl ring, which contributes to its unique three-dimensional structure and potential reactivity. The presence of the 3,5-dimethylphenyl group enhances its hydrophobic characteristics and may influence its solubility in organic solvents. This compound is likely to exhibit moderate volatility and stability under standard conditions, making it suitable for various synthetic applications in organic chemistry. Its molecular structure suggests potential uses in the development of pharmaceuticals or agrochemicals, where the cyclobutyl moiety can impart specific biological activities. Additionally, the compound's reactivity may allow for further functionalization, enabling the synthesis of more complex molecules. As with many organic compounds, safety data should be consulted to understand its handling, storage, and potential hazards. Overall, 1-Cyclobutyl-3-(3,5-dimethylphenyl)-1-propanone represents a versatile building block in organic synthesis.
Formula:C15H20O
InChI:InChI=1S/C15H20O/c1-11-8-12(2)10-13(9-11)6-7-15(16)14-4-3-5-14/h8-10,14H,3-7H2,1-2H3
InChI key:InChIKey=MEQIAOZRCRNNDD-UHFFFAOYSA-N
SMILES:C(CC(=O)C1CCC1)C2=CC(C)=CC(C)=C2
Synonyms:- 1-Propanone, 1-cyclobutyl-3-(3,5-dimethylphenyl)-
- 1-Cyclobutyl-3-(3,5-dimethylphenyl)-1-propanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.