CAS 898781-33-4

1-Propanone, 1-(3,4-dimethylphenyl)-3-[4-(methylthio)phenyl]-

Description:

1-Propanone, 1-(3,4-dimethylphenyl)-3-[4-(methylthio)phenyl]- is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a 3,4-dimethylphenyl group and a 4-(methylthio)phenyl group. The presence of the methylthio group introduces sulfur into the molecular structure, which can influence the compound's reactivity and solubility. The overall molecular structure suggests potential applications in organic synthesis and materials science, particularly in the development of pharmaceuticals or agrochemicals. Its physical properties, such as boiling point, melting point, and solubility, would depend on the specific interactions between the aromatic rings and the ketone group, as well as the steric effects of the methyl groups. Additionally, the compound's stability and reactivity may be affected by the presence of the sulfur atom and the overall electronic distribution within the molecule.

Formula: C₁₈H₂₀OS

InChI: InChI=1/C18H20OS/c1-13-4-8-16(12-14(13)2)18(19)11-7-15-5-9-17(20-3)10-6-15/h4-6,8-10,12H,7,11H2,1-3H3

InChI key: InChIKey=NNUXCQQINHGJPJ-UHFFFAOYSA-N

SMILES: C(CCC1=CC=C(SC)C=C1)(=O)C2=CC(C)=C(C)C=C2

Synonyms:

• 1-Propanone, 1-(3,4-dimethylphenyl)-3-[4-(methylthio)phenyl]-
• 1-(3,4-Dimethylphenyl)-3-[4-(methylsulfanyl)phenyl]-1-propanone

3′,4′-dimethyl-3-(4-thiomethylphenyl)propiophenone

CAS: 898781-33-4

Formula: C₁₈H₂₀OS

Purity: 97.0%

Molecular weight: 284.42

Ref: 10-F206013