CAS 898781-38-9
:o-tolyl-[2-(thiomorpholinomethyl)phenyl]methanone
Description:
o-Tolyl-[2-(thiomorpholinomethyl)phenyl]methanone, with the CAS number 898781-38-9, is a chemical compound characterized by its complex structure, which includes a tolyl group and a thiomorpholine moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential solubility in organic solvents and moderate stability under standard conditions. The presence of the thiomorpholine ring suggests that it may possess unique reactivity patterns, particularly in nucleophilic substitution reactions. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure allows for interactions with various biological targets, which could lead to potential therapeutic applications. However, specific physical properties such as melting point, boiling point, and solubility would need to be determined experimentally or sourced from reliable databases for precise characterization. Overall, o-tolyl-[2-(thiomorpholinomethyl)phenyl]methanone represents a compound of interest in both synthetic and medicinal chemistry.
Formula:C19H21NOS
InChI:InChI=1/C19H21NOS/c1-15-6-2-4-8-17(15)19(21)18-9-5-3-7-16(18)14-20-10-12-22-13-11-20/h2-9H,10-14H2,1H3
SMILES:Cc1ccccc1C(=O)c1ccccc1CN1CCSCC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.