CAS 898781-39-0

1-(4-bromo-3-fluoro-phenyl)-3-(4-methylsulfanylphenyl)propan-1-one

Description:

1-(4-bromo-3-fluoro-phenyl)-3-(4-methylsulfanylphenyl)propan-1-one, with the CAS number 898781-39-0, is an organic compound characterized by its complex structure featuring a propanone backbone. This compound contains a phenyl ring substituted with a bromine atom and a fluorine atom, contributing to its unique electronic properties and potential reactivity. Additionally, it has another phenyl group that is substituted with a methylsulfanyl group, which can influence its solubility and interaction with biological systems. The presence of halogen atoms (bromine and fluorine) often enhances the compound's lipophilicity and may affect its pharmacological properties. The methylsulfanyl group can also play a role in the compound's reactivity and stability. Overall, this compound may exhibit interesting chemical behavior and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals, due to its diverse functional groups and structural features.

Formula: C₁₆H₁₄BrFOS

InChI: InChI=1/C16H14BrFOS/c1-20-13-6-2-11(3-7-13)4-9-16(19)12-5-8-14(17)15(18)10-12/h2-3,5-8,10H,4,9H2,1H3

SMILES: CSc1ccc(cc1)CCC(=O)c1ccc(c(c1)F)Br