CAS 898781-40-3
:3-(4-chloro-3-fluoro-phenyl)-1-(2,6-dichlorophenyl)propan-1-one
Description:
3-(4-chloro-3-fluoro-phenyl)-1-(2,6-dichlorophenyl)propan-1-one, with the CAS number 898781-40-3, is a synthetic organic compound characterized by its complex structure, which includes multiple halogen substituents. This compound features a propanone backbone, with a phenyl group substituted at one end and another phenyl group that is further substituted with two chlorine atoms at the 2 and 6 positions. The presence of both chlorine and fluorine atoms contributes to its unique chemical properties, potentially enhancing its reactivity and biological activity. The compound may exhibit significant lipophilicity due to its aromatic rings, which can influence its solubility and interaction with biological systems. Such characteristics make it of interest in various fields, including medicinal chemistry and materials science. However, specific applications and biological effects would depend on further studies and evaluations of its pharmacological properties. As with many halogenated compounds, considerations regarding environmental impact and safety are also important.
Formula:C15H10Cl3FO
InChI:InChI=1/C15H10Cl3FO/c16-10-6-4-9(8-13(10)19)5-7-14(20)15-11(17)2-1-3-12(15)18/h1-4,6,8H,5,7H2
SMILES:c1cc(c(c(c1)Cl)C(=O)CCc1ccc(c(c1)F)Cl)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.