CAS 898781-42-5

1-(4-chloro-3-fluoro-phenyl)-3-(4-methylsulfanylphenyl)propan-1-one

Description:

1-(4-chloro-3-fluoro-phenyl)-3-(4-methylsulfanylphenyl)propan-1-one, identified by its CAS number 898781-42-5, is an organic compound characterized by its complex structure, which includes a propanone backbone substituted with a chloro and a fluoro group on one phenyl ring, and a methylsulfanyl group on another phenyl ring. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for various chemical reactions, including electrophilic substitutions. The presence of halogen atoms (chlorine and fluorine) can influence its reactivity and polarity, while the methylsulfanyl group may enhance its solubility in organic solvents. Such compounds are often of interest in medicinal chemistry and materials science due to their potential biological activity and utility in synthesizing more complex molecules. Additionally, the specific arrangement of functional groups can affect the compound's physical properties, such as melting point, boiling point, and solubility, making it a subject of study in various chemical applications.

Formula: C₁₆H₁₄ClFOS

InChI: InChI=1/C16H14ClFOS/c1-20-13-6-2-11(3-7-13)4-9-16(19)12-5-8-14(17)15(18)10-12/h2-3,5-8,10H,4,9H2,1H3

SMILES: CSc1ccc(cc1)CCC(=O)c1ccc(c(c1)F)Cl