CAS 898781-45-8

1-Propanone, 1-(3-chloro-4-fluorophenyl)-3-[4-(methylthio)phenyl]-

Description:

1-Propanone, 1-(3-chloro-4-fluorophenyl)-3-[4-(methylthio)phenyl]- is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with substituents that include a 3-chloro-4-fluorophenyl group and a 4-(methylthio)phenyl group, contributing to its unique chemical properties. The presence of halogen atoms (chlorine and fluorine) typically enhances the compound's reactivity and can influence its solubility and stability. The methylthio group may also affect the compound's electronic properties and steric hindrance. As a ketone, it is likely to exhibit typical ketone reactivity, including nucleophilic addition reactions. The compound's molecular structure suggests potential applications in pharmaceuticals or agrochemicals, where such substituents can modulate biological activity. However, specific physical properties such as boiling point, melting point, and solubility would require empirical data for precise characterization. Overall, this compound exemplifies the complexity and diversity of organic molecules in chemical synthesis and application.

Formula: C₁₆H₁₄ClFOS

InChI: InChI=1S/C16H14ClFOS/c1-20-13-6-2-11(3-7-13)4-9-16(19)12-5-8-15(18)14(17)10-12/h2-3,5-8,10H,4,9H2,1H3

InChI key: InChIKey=DKJXPGSXEUOUHN-UHFFFAOYSA-N

SMILES: C(CCC1=CC=C(SC)C=C1)(=O)C2=CC(Cl)=C(F)C=C2

Synonyms:

• 1-Propanone, 1-(3-chloro-4-fluorophenyl)-3-[4-(methylthio)phenyl]-
• 1-(3-Chloro-4-fluorophenyl)-3-[4-(methylsulfanyl)phenyl]-1-propanone

3′-chloro-4′-fluoro-3-(4-thiomethylphenyl)propiophenone

CAS: 898781-45-8

Formula: C₁₆H₁₄ClFOS

Purity: 97.0%

Molecular weight: 308.8

Ref: 10-F206017