CAS 898781-48-1
:1-(2-chlorophenyl)-3-(4-methylsulfanylphenyl)propan-1-one
Description:
1-(2-Chlorophenyl)-3-(4-methylsulfanylphenyl)propan-1-one, with the CAS number 898781-48-1, is an organic compound that belongs to the class of ketones. It features a propanone backbone substituted with a 2-chlorophenyl group and a 4-methylsulfanylphenyl group, which contribute to its unique chemical properties. The presence of the chlorine atom introduces electronegativity, potentially influencing the compound's reactivity and polarity. The methylsulfanyl group enhances the compound's lipophilicity, which may affect its solubility in organic solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its structural characteristics suggest potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, the compound's stability and reactivity can be influenced by the functional groups present, which may participate in various chemical reactions, including nucleophilic substitutions and electrophilic additions. Overall, this compound represents a complex structure with potential implications in various chemical and biological contexts.
Formula:C16H15ClOS
InChI:InChI=1/C16H15ClOS/c1-19-13-9-6-12(7-10-13)8-11-16(18)14-4-2-3-5-15(14)17/h2-7,9-10H,8,11H2,1H3
SMILES:CSc1ccc(cc1)CCC(=O)c1ccccc1Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.