CymitQuimica logo

CAS 898781-53-8

:

1-Propanone, 3-[4-(methylthio)phenyl]-1-[2-(trifluoromethyl)phenyl]-

Description:
1-Propanone, 3-[4-(methylthio)phenyl]-1-[2-(trifluoromethyl)phenyl]- is an organic compound characterized by its ketone functional group, which is central to its structure. The presence of the methylthio group indicates a sulfur atom bonded to a methyl group, contributing to its unique chemical properties and potential reactivity. The compound also features two distinct phenyl rings, one substituted with a trifluoromethyl group, which enhances its electron-withdrawing characteristics, potentially affecting its reactivity and interactions with other molecules. This compound may exhibit moderate to high lipophilicity due to the presence of aromatic rings, influencing its solubility in organic solvents. Additionally, the trifluoromethyl group can impart unique electronic properties, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. Its specific reactivity and applications would depend on the context of its use, including potential roles in synthesis or as an intermediate in chemical reactions. Safety and handling considerations should be taken into account due to the presence of sulfur and fluorine in its structure.
Formula:C17H15F3OS
InChI:InChI=1S/C17H15F3OS/c1-22-13-9-6-12(7-10-13)8-11-16(21)14-4-2-3-5-15(14)17(18,19)20/h2-7,9-10H,8,11H2,1H3
InChI key:InChIKey=ODLFTXVOXRLFCM-UHFFFAOYSA-N
SMILES:C(CCC1=CC=C(SC)C=C1)(=O)C2=C(C(F)(F)F)C=CC=C2
Synonyms:
  • 1-Propanone, 3-[4-(methylthio)phenyl]-1-[2-(trifluoromethyl)phenyl]-
  • 3-[4-(Methylsulfanyl)phenyl]-1-[2-(trifluoromethyl)phenyl]-1-propanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.