CAS 898781-57-2

3-(4-methylsulfanylphenyl)-1-[4-(trifluoromethyl)phenyl]propan-1-one

Description:

3-(4-Methylsulfanylphenyl)-1-[4-(trifluoromethyl)phenyl]propan-1-one, with the CAS number 898781-57-2, is an organic compound characterized by its complex structure featuring a propanone backbone. This compound contains a methylsulfanyl group, which contributes to its potential reactivity and solubility properties, and a trifluoromethyl group, known for enhancing lipophilicity and biological activity. The presence of these functional groups suggests that the compound may exhibit interesting pharmacological properties, making it a candidate for research in medicinal chemistry. Its molecular structure indicates that it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic additions. Additionally, the compound's stability and reactivity can be influenced by the steric and electronic effects of the substituents on the aromatic rings. Overall, this compound's unique characteristics make it a subject of interest in the fields of organic synthesis and drug development.

Formula: C₁₇H₁₅F₃OS

InChI: InChI=1/C17H15F3OS/c1-22-15-9-2-12(3-10-15)4-11-16(21)13-5-7-14(8-6-13)17(18,19)20/h2-3,5-10H,4,11H2,1H3

SMILES: CSc1ccc(cc1)CCC(=O)c1ccc(cc1)C(F)(F)F