CAS 898781-59-4

1-(4-bromo-2-fluoro-phenyl)-3-(4-methylsulfanylphenyl)propan-1-one

Description:

1-(4-bromo-2-fluoro-phenyl)-3-(4-methylsulfanylphenyl)propan-1-one, with the CAS number 898781-59-4, is an organic compound characterized by its complex structure, which includes a propanone backbone substituted with a bromo and a fluoro group on one phenyl ring and a methylthio group on another. This compound is likely to exhibit properties typical of ketones, such as being a polar molecule due to the carbonyl group, which can engage in hydrogen bonding. The presence of halogen substituents (bromo and fluoro) can influence its reactivity and lipophilicity, potentially enhancing its biological activity. The methylthio group may also contribute to its electronic properties and steric effects. Such compounds are often of interest in medicinal chemistry and material science due to their potential applications in drug development and as intermediates in organic synthesis. However, specific physical properties like melting point, boiling point, and solubility would require empirical measurement or literature reference for precise values.

Formula: C₁₆H₁₄BrFOS

InChI: InChI=1/C16H14BrFOS/c1-20-13-6-2-11(3-7-13)4-9-16(19)14-8-5-12(17)10-15(14)18/h2-3,5-8,10H,4,9H2,1H3

SMILES: CSc1ccc(cc1)CCC(=O)c1ccc(cc1F)Br