CAS 898781-65-2

1-(4-chloro-2-fluoro-phenyl)-3-(4-methylsulfanylphenyl)propan-1-one

Description:

1-(4-chloro-2-fluoro-phenyl)-3-(4-methylsulfanylphenyl)propan-1-one, identified by its CAS number 898781-65-2, is an organic compound characterized by its complex structure featuring a propanone backbone. This compound contains a phenyl group substituted with both a chlorine and a fluorine atom, which contributes to its unique electronic properties and potential reactivity. Additionally, it has a second phenyl group that is substituted with a methylsulfanyl group, enhancing its lipophilicity and possibly influencing its biological activity. The presence of halogen atoms often affects the compound's stability and solubility in various solvents. This compound may be of interest in medicinal chemistry and material science due to its potential applications in drug development or as a building block in organic synthesis. Its specific properties, such as melting point, boiling point, and solubility, would need to be determined experimentally or sourced from reliable chemical databases for practical applications.

Formula: C₁₆H₁₄ClFOS

InChI: InChI=1/C16H14ClFOS/c1-20-13-6-2-11(3-7-13)4-9-16(19)14-8-5-12(17)10-15(14)18/h2-3,5-8,10H,4,9H2,1H3

SMILES: CSc1ccc(cc1)CCC(=O)c1ccc(cc1F)Cl