CAS 898781-66-3
:(2-methylsulfanylphenyl)-[2-(thiomorpholinomethyl)phenyl]methanone
Description:
The chemical substance known as (2-methylsulfanylphenyl)-[2-(thiomorpholinomethyl)phenyl]methanone, with the CAS number 898781-66-3, is a synthetic organic compound characterized by its complex structure, which includes a ketone functional group and multiple aromatic rings. It features a methylsulfanyl group, which contributes to its potential reactivity and solubility properties. The presence of a thiomorpholine moiety suggests that the compound may exhibit interesting pharmacological activities, as thiomorpholines are often associated with biological activity. This compound is likely to be a solid at room temperature, with potential applications in medicinal chemistry or as a building block in organic synthesis. Its specific physical properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the overall structure. As with many synthetic compounds, safety data and handling precautions should be considered, particularly regarding its potential toxicity and environmental impact. Further studies would be necessary to fully elucidate its chemical behavior and potential applications.
Formula:C19H21NOS2
InChI:InChI=1/C19H21NOS2/c1-22-18-9-5-4-8-17(18)19(21)16-7-3-2-6-15(16)14-20-10-12-23-13-11-20/h2-9H,10-14H2,1H3
SMILES:CSc1ccccc1C(=O)c1ccccc1CN1CCSCC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.