CAS 898781-67-4

1-(2,3-dichlorophenyl)-3-(4-methylsulfanylphenyl)propan-1-one

Description:

1-(2,3-Dichlorophenyl)-3-(4-methylsulfanylphenyl)propan-1-one, with the CAS number 898781-67-4, is an organic compound characterized by its complex structure, which includes a propanone backbone substituted with a dichlorophenyl group and a methylsulfanylphenyl group. This compound typically exhibits properties associated with ketones, such as being a liquid or solid at room temperature, depending on its specific formulation and purity. It may possess moderate to high lipophilicity due to the presence of aromatic rings, which can influence its solubility in organic solvents. The dichlorophenyl moiety may impart unique electronic properties, potentially affecting its reactivity and interaction with biological systems. Additionally, the methylsulfanyl group can enhance its chemical stability and influence its pharmacological activity. As with many organic compounds, safety data should be consulted, as it may pose risks such as toxicity or environmental hazards. Overall, this compound is of interest in various fields, including medicinal chemistry and materials science, due to its potential applications.

Formula: C₁₆H₁₄Cl₂OS

InChI: InChI=1/C16H14Cl2OS/c1-20-12-8-5-11(6-9-12)7-10-15(19)13-3-2-4-14(17)16(13)18/h2-6,8-9H,7,10H2,1H3

SMILES: CSc1ccc(cc1)CCC(=O)c1cccc(c1Cl)Cl