CAS 898781-69-6
:1-(2,4-dichlorophenyl)-3-(4-methylsulfanylphenyl)propan-1-one
Description:
1-(2,4-Dichlorophenyl)-3-(4-methylsulfanylphenyl)propan-1-one, identified by its CAS number 898781-69-6, is an organic compound characterized by its complex structure featuring a propanone backbone. This substance contains a dichlorophenyl group, which contributes to its potential biological activity, and a methylsulfanylphenyl group that may influence its solubility and reactivity. The presence of chlorine atoms in the dichlorophenyl moiety enhances the compound's lipophilicity, potentially affecting its interaction with biological systems. The methylsulfanyl group introduces a sulfur atom, which can participate in various chemical reactions, including nucleophilic substitutions. This compound is likely to exhibit properties typical of ketones, such as being a polar solvent and participating in condensation reactions. Its unique structure suggests potential applications in pharmaceuticals or agrochemicals, although specific biological activities would require further investigation. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or environmental impact.
Formula:C16H14Cl2OS
InChI:InChI=1/C16H14Cl2OS/c1-20-13-6-2-11(3-7-13)4-9-16(19)14-8-5-12(17)10-15(14)18/h2-3,5-8,10H,4,9H2,1H3
SMILES:CSc1ccc(cc1)CCC(=O)c1ccc(cc1Cl)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.