CAS 898781-70-9

(3-Bromophenyl)[2-(4-thiomorpholinylmethyl)phenyl]methanone

Description:

(3-Bromophenyl)[2-(4-thiomorpholinylmethyl)phenyl]methanone is a synthetic organic compound characterized by its complex structure, which includes a bromophenyl group and a thiomorpholine moiety. The presence of the bromine atom introduces significant electronegativity, influencing the compound's reactivity and potential applications in medicinal chemistry. The thiomorpholine ring contributes to the compound's pharmacological properties, often enhancing solubility and bioavailability. This compound may exhibit various biological activities, making it of interest in drug discovery and development. Its methanone functional group indicates the presence of a carbonyl, which can participate in various chemical reactions, such as nucleophilic additions. The overall molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic purposes. As with many synthetic compounds, safety and handling precautions are essential, given the potential toxicity associated with halogenated and sulfur-containing compounds. Further studies would be necessary to fully elucidate its properties, including solubility, stability, and biological activity.

Formula: C₁₈H₁₈BrNOS

InChI: InChI=1S/C18H18BrNOS/c19-16-6-3-5-14(12-16)18(21)17-7-2-1-4-15(17)13-20-8-10-22-11-9-20/h1-7,12H,8-11,13H2

InChI key: InChIKey=DZJQNFBDGQKAKN-UHFFFAOYSA-N

SMILES: C(C1=C(C(=O)C2=CC(Br)=CC=C2)C=CC=C1)N3CCSCC3

Synonyms:

• Methanone, (3-bromophenyl)[2-(4-thiomorpholinylmethyl)phenyl]-
• (3-Bromophenyl)[2-(4-thiomorpholinylmethyl)phenyl]methanone

3′-bromo-2-thiomorpholinomethyl benzophenone

CAS: 898781-70-9

Formula: C₁₈H₁₈BrNOS

Purity: 97.0%

Molecular weight: 376.31

Ref: 10-F205409