CAS 898781-71-0

1-(2,5-dichlorophenyl)-3-(4-methylsulfanylphenyl)propan-1-one

Description:

1-(2,5-Dichlorophenyl)-3-(4-methylsulfanylphenyl)propan-1-one, identified by its CAS number 898781-71-0, is an organic compound characterized by its complex structure, which includes a propanone backbone substituted with a dichlorophenyl group and a methylsulfanylphenyl group. This compound typically exhibits properties associated with ketones, such as being a liquid or solid at room temperature, depending on its specific formulation and purity. The presence of chlorine and sulfur substituents can influence its reactivity, solubility, and potential biological activity. It may be used in various applications, including pharmaceuticals or as an intermediate in organic synthesis. The dichlorophenyl group can enhance the compound's lipophilicity, while the methylsulfanyl group may impart unique electronic properties. As with many organic compounds, safety precautions should be taken when handling this substance, as it may pose health risks or environmental hazards. Proper storage and disposal methods are essential to mitigate any potential risks associated with its use.

Formula: C₁₆H₁₄Cl₂OS

InChI: InChI=1/C16H14Cl2OS/c1-20-13-6-2-11(3-7-13)4-9-16(19)14-10-12(17)5-8-15(14)18/h2-3,5-8,10H,4,9H2,1H3

SMILES: CSc1ccc(cc1)CCC(=O)c1cc(ccc1Cl)Cl