CAS 898781-72-1

(4-bromophenyl)-[2-(thiomorpholinomethyl)phenyl]methanone

Description:

(4-bromophenyl)-[2-(thiomorpholinomethyl)phenyl]methanone, identified by its CAS number 898781-72-1, is a synthetic organic compound characterized by its complex structure, which includes a bromophenyl group and a thiomorpholine moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to the presence of the thiomorpholine ring, which can influence its interaction with biological targets. The bromine substituent may enhance lipophilicity and affect the compound's reactivity and stability. As a ketone, it features a carbonyl group that can participate in various chemical reactions, such as nucleophilic additions. The compound's solubility, melting point, and other physical properties would depend on its molecular interactions and the presence of functional groups. Overall, this compound may be of interest in medicinal chemistry and drug development, particularly for its potential pharmacological applications. However, specific experimental data would be necessary to fully characterize its behavior and applications in various contexts.

Formula: C₁₈H₁₈BrNOS

InChI: InChI=1/C18H18BrNOS/c19-16-7-5-14(6-8-16)18(21)17-4-2-1-3-15(17)13-20-9-11-22-12-10-20/h1-8H,9-13H2

SMILES: c1ccc(c(c1)CN1CCSCC1)C(=O)c1ccc(cc1)Br

4′-bromo-2-thiomorpholinomethyl benzophenone

CAS: 898781-72-1

Formula: C₁₈H₁₈BrNOS

Purity: 97.0%

Molecular weight: 376.31

Ref: 10-F205410