CAS 898781-79-8

1-(3,4-difluorophenyl)-3-(4-methylsulfanylphenyl)propan-1-one

Description:

1-(3,4-Difluorophenyl)-3-(4-methylsulfanylphenyl)propan-1-one, identified by its CAS number 898781-79-8, is an organic compound characterized by its ketone functional group and a complex aromatic structure. This compound features a propanone backbone with two distinct aromatic substituents: a 3,4-difluorophenyl group and a 4-methylsulfanylphenyl group. The presence of fluorine atoms in the aromatic ring can influence the compound's electronic properties, potentially enhancing its reactivity and solubility in various solvents. The methylsulfanyl group introduces a sulfur atom, which can affect the compound's overall polarity and interaction with biological systems. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its synthesis typically involves multi-step organic reactions, and it may be analyzed using techniques such as NMR spectroscopy, mass spectrometry, and chromatography to confirm its structure and purity. Overall, the unique combination of functional groups and substituents contributes to its potential applications in various fields, including pharmaceuticals and materials science.

Formula: C₁₆H₁₄F₂OS

InChI: InChI=1/C16H14F2OS/c1-20-13-6-2-11(3-7-13)4-9-16(19)12-5-8-14(17)15(18)10-12/h2-3,5-8,10H,4,9H2,1H3

SMILES: CSc1ccc(cc1)CCC(=O)c1ccc(c(c1)F)F