CymitQuimica logo

CAS 898781-84-5

:

(2,4-dimethylphenyl)-[2-(thiomorpholinomethyl)phenyl]methanone

Description:
The chemical substance known as (2,4-dimethylphenyl)-[2-(thiomorpholinomethyl)phenyl]methanone, with the CAS number 898781-84-5, is a synthetic organic compound characterized by its complex structure that includes a ketone functional group and a thiomorpholine moiety. This compound features a phenyl ring substituted with two methyl groups at the 2 and 4 positions, enhancing its hydrophobic characteristics and potentially influencing its biological activity. The presence of the thiomorpholinomethyl group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the thiomorpholine's ability to interact with biological targets. The compound's molecular structure may impart specific properties such as solubility, stability, and reactivity, which are critical for its function in various chemical and biological contexts. Additionally, its unique arrangement of functional groups may allow for diverse interactions, making it a candidate for further research in drug development and other applications in organic synthesis.
Formula:C20H23NOS
InChI:InChI=1/C20H23NOS/c1-15-7-8-18(16(2)13-15)20(22)19-6-4-3-5-17(19)14-21-9-11-23-12-10-21/h3-8,13H,9-12,14H2,1-2H3
SMILES:Cc1ccc(c(C)c1)C(=O)c1ccccc1CN1CCSCC1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.