CAS 898781-85-6

1-Propanone, 1-(2,6-dichlorophenyl)-3-[4-(methylthio)phenyl]-

Description:

1-Propanone, 1-(2,6-dichlorophenyl)-3-[4-(methylthio)phenyl]- is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with a dichlorophenyl group and a methylthio-substituted phenyl group, contributing to its unique chemical properties. The presence of chlorine atoms enhances its reactivity and may influence its biological activity, while the methylthio group can affect its solubility and interaction with other molecules. Typically, compounds of this nature are studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The molecular structure suggests that it may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's stability, solubility, and reactivity can vary based on environmental conditions and the presence of other chemical species. Overall, this compound exemplifies the complexity and diversity of organic molecules in chemical research.

Formula: C₁₆H₁₄Cl₂OS

InChI: InChI=1S/C16H14Cl2OS/c1-20-12-8-5-11(6-9-12)7-10-15(19)16-13(17)3-2-4-14(16)18/h2-6,8-9H,7,10H2,1H3

InChI key: InChIKey=ANBWNKHZSZBPIW-UHFFFAOYSA-N

SMILES: C(CCC1=CC=C(SC)C=C1)(=O)C2=C(Cl)C=CC=C2Cl

Synonyms:

• 1-Propanone, 1-(2,6-dichlorophenyl)-3-[4-(methylthio)phenyl]-
• 1-(2,6-Dichlorophenyl)-3-[4-(methylsulfanyl)phenyl]-1-propanone