CAS 898781-86-7

Methanone, (2,5-dimethylphenyl)[2-(4-thiomorpholinylmethyl)phenyl]-

Description:

Methanone, (2,5-dimethylphenyl)[2-(4-thiomorpholinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of the 2,5-dimethylphenyl group indicates that it has two methyl substituents on the phenyl ring, contributing to its hydrophobic character. Additionally, the compound features a thiomorpholine moiety, which introduces a sulfur atom into the structure, potentially affecting its reactivity and solubility. This compound may exhibit interesting biological properties due to its unique arrangement of functional groups, making it a candidate for various applications in medicinal chemistry. Its molecular interactions could be influenced by the steric and electronic effects of the substituents, which may play a role in its pharmacological activity. As with many organic compounds, the stability, reactivity, and potential applications of this substance would depend on its specific molecular interactions and the conditions under which it is studied.

Formula: C₂₀H₂₃NOS

InChI: InChI=1S/C20H23NOS/c1-15-7-8-16(2)19(13-15)20(22)18-6-4-3-5-17(18)14-21-9-11-23-12-10-21/h3-8,13H,9-12,14H2,1-2H3

InChI key: InChIKey=TWMPZBLZQPZLFG-UHFFFAOYSA-N

SMILES: C(C1=C(C(=O)C2=C(C)C=CC(C)=C2)C=CC=C1)N3CCSCC3

Synonyms:

• Methanone, (2,5-dimethylphenyl)[2-(4-thiomorpholinylmethyl)phenyl]-
• 2,5-Dimethyl-2′-thiomorpholinomethyl benzophenone