CAS 898781-88-9

Methanone, (2,6-dimethylphenyl)[2-(4-thiomorpholinylmethyl)phenyl]-

Description:

Methanone, (2,6-dimethylphenyl)[2-(4-thiomorpholinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of the 2,6-dimethylphenyl group indicates that it has two methyl substituents on the phenyl ring, contributing to its hydrophobic character. The compound also features a thiomorpholine moiety, which introduces a sulfur atom into the structure, enhancing its potential for biological activity and interaction with various biological targets. This compound may exhibit properties such as moderate solubility in organic solvents and potential reactivity due to the presence of the carbonyl group. Its unique structure suggests possible applications in medicinal chemistry, particularly in the development of pharmaceuticals, where the combination of aromatic and heterocyclic components can influence biological activity. However, specific physical and chemical properties such as melting point, boiling point, and solubility would require empirical measurement or detailed literature references for precise characterization.

Formula: C₂₀H₂₃NOS

InChI: InChI=1S/C20H23NOS/c1-15-6-5-7-16(2)19(15)20(22)18-9-4-3-8-17(18)14-21-10-12-23-13-11-21/h3-9H,10-14H2,1-2H3

InChI key: InChIKey=KPEQPYOGAYAINA-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(CN2CCSCC2)C=CC=C1)C3=C(C)C=CC=C3C

Synonyms:

• 2,6-Dimethyl-2′-thiomorpholinomethyl benzophenone
• (2,6-Dimethylphenyl)[2-(4-thiomorpholinylmethyl)phenyl]methanone
• Methanone, (2,6-dimethylphenyl)[2-(4-thiomorpholinylmethyl)phenyl]-

2,6-dimethyl-2′-thiomorpholinomethyl benzophenone

CAS: 898781-88-9

Formula: C₂₀H₂₃NOS

Purity: 97.0%

Molecular weight: 325.47

Ref: 10-F205418