CAS 898781-90-3

Methanone, (3,4-dimethylphenyl)[2-(4-thiomorpholinylmethyl)phenyl]-

Description:

Methanone, (3,4-dimethylphenyl)[2-(4-thiomorpholinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of the 3,4-dimethylphenyl group indicates that it has two methyl substituents on a phenyl ring, contributing to its hydrophobic characteristics and potential for increased lipophilicity. The compound also features a thiomorpholine moiety, which is a six-membered ring containing sulfur and nitrogen, suggesting potential for biological activity due to its ability to interact with various biological targets. The overall structure implies that it may exhibit properties such as moderate to high stability under standard conditions, and it may participate in various chemical reactions typical of ketones and aromatic compounds. Additionally, the presence of multiple functional groups may influence its solubility, reactivity, and potential applications in pharmaceuticals or materials science. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.

Formula: C₂₀H₂₃NOS

InChI: InChI=1S/C20H23NOS/c1-15-7-8-17(13-16(15)2)20(22)19-6-4-3-5-18(19)14-21-9-11-23-12-10-21/h3-8,13H,9-12,14H2,1-2H3

InChI key: InChIKey=HEBAQIFZJPBNAZ-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(CN2CCSCC2)C=CC=C1)C3=CC(C)=C(C)C=C3

Synonyms:

• Methanone, (3,4-dimethylphenyl)[2-(4-thiomorpholinylmethyl)phenyl]-
• (3,4-Dimethylphenyl)[2-(4-thiomorpholinylmethyl)phenyl]methanone
• 3,4-Dimethyl-2′-thiomorpholinomethyl benzophenone