CAS 898781-91-4

1-Cyclopentyl-3-[4-(methylthio)phenyl]-1-propanone

Description:

1-Cyclopentyl-3-[4-(methylthio)phenyl]-1-propanone, with the CAS number 898781-91-4, is an organic compound characterized by its unique molecular structure, which includes a cyclopentyl group and a phenyl ring substituted with a methylthio group. This compound typically exhibits properties associated with ketones, such as being a liquid at room temperature and having a moderate boiling point. Its molecular structure suggests potential applications in organic synthesis and as an intermediate in the production of pharmaceuticals or agrochemicals. The presence of the methylthio group may impart specific reactivity or solubility characteristics, influencing its behavior in various chemical reactions. Additionally, the compound's stability and reactivity can be affected by the steric and electronic effects of the cyclopentyl and phenyl groups. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure proper safety measures are in place.

Formula: C₁₅H₂₀OS

InChI: InChI=1/C15H20OS/c1-17-14-9-6-12(7-10-14)8-11-15(16)13-4-2-3-5-13/h6-7,9-10,13H,2-5,8,11H2,1H3

InChI key: InChIKey=NLTXNOMHAOYRFO-UHFFFAOYSA-N

SMILES: C(CCC1=CC=C(SC)C=C1)(=O)C2CCCC2

Synonyms:

• 1-Cyclopentyl-3-[4-(methylthio)phenyl]-1-propanone
• 1-Propanone, 1-cyclopentyl-3-[4-(methylthio)phenyl]-

cyclopentyl 2-(4-thiomethylphenyl)ethyl ketone

CAS: 898781-91-4

Formula: C₁₅H₂₀OS

Purity: 97.0%

Molecular weight: 248.38

Ref: 10-F206039