CAS 898781-98-1

Methanone, (3-chloro-4-fluorophenyl)[2-(4-thiomorpholinylmethyl)phenyl]-

Description:

Methanone, (3-chloro-4-fluorophenyl)[2-(4-thiomorpholinylmethyl)phenyl]- is a synthetic organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a chloro and a fluoro substituent on the phenyl ring contributes to its unique chemical reactivity and potential biological activity. The thiomorpholine moiety introduces a sulfur atom into the structure, which can influence the compound's pharmacological properties and solubility. This compound is likely to exhibit specific interactions with biological targets, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in the fields of oncology or neurology, where such compounds may act as inhibitors or modulators of biological pathways. As with many synthetic compounds, the stability, solubility, and reactivity can vary based on environmental conditions and the presence of other chemical species. Safety and handling precautions should be observed due to the presence of halogenated groups, which can pose environmental and health risks.

Formula: C₁₈H₁₇ClFNOS

InChI: InChI=1S/C18H17ClFNOS/c19-16-11-13(5-6-17(16)20)18(22)15-4-2-1-3-14(15)12-21-7-9-23-10-8-21/h1-6,11H,7-10,12H2

InChI key: InChIKey=VUCPOYHJTGLDGJ-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(CN2CCSCC2)C=CC=C1)C3=CC(Cl)=C(F)C=C3

Synonyms:

• Methanone, (3-chloro-4-fluorophenyl)[2-(4-thiomorpholinylmethyl)phenyl]-
• (3-Chloro-4-fluorophenyl)[2-(4-thiomorpholinylmethyl)phenyl]methanone
• 3-Chloro-4-fluoro-2′-thiomorpholinomethyl benzophenone

3-chloro-4-fluoro-2′-thiomorpholinomethyl benzophenone

CAS: 898781-98-1

Formula: C₁₈H₁₇ClFNOS

Purity: 97.0%

Molecular weight: 349.85

Ref: 10-F205423