CAS 898782-00-8

(2-chlorophenyl)-[2-(thiomorpholinomethyl)phenyl]methanone

Description:

(2-chlorophenyl)-[2-(thiomorpholinomethyl)phenyl]methanone, identified by its CAS number 898782-00-8, is a synthetic organic compound characterized by its complex structure, which includes a chlorinated phenyl group and a thiomorpholine moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential lipophilicity due to the presence of multiple aromatic rings. The chlorophenyl group may impart specific electronic properties, influencing its reactivity and interaction with biological targets. The thiomorpholine component suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as it may enhance solubility and bioavailability. The compound's molecular structure indicates it could participate in various chemical reactions, such as nucleophilic substitutions or electrophilic aromatic substitutions, depending on the reaction conditions. Overall, this compound's unique characteristics make it a subject of interest in research, particularly in the fields of drug design and development. However, specific safety and handling guidelines should be followed due to the presence of chlorine and other reactive functional groups.

Formula: C₁₈H₁₈ClNOS

InChI: InChI=1/C18H18ClNOS/c19-17-8-4-3-7-16(17)18(21)15-6-2-1-5-14(15)13-20-9-11-22-12-10-20/h1-8H,9-13H2

SMILES: c1ccc(c(c1)CN1CCSCC1)C(=O)c1ccccc1Cl

Synonyms:

• 2-CHLORO-2'-THIOMORPHOLINOMETHYL BENZOPHENONE
• Methanone, (2-chlorophenyl)[2-(4-thiomorpholinylmethyl)phenyl]-

2-chloro-2′-thiomorpholinomethyl benzophenone

CAS: 898782-00-8

Formula: C₁₈H₁₈ClNOS

Purity: 97.0%

Molecular weight: 331.86

Ref: 10-F205424