CAS 898782-05-3

[2-(thiomorpholinomethyl)phenyl]-[2-(trifluoromethyl)phenyl]methanone

Description:

The chemical substance known as [2-(thiomorpholinomethyl)phenyl]-[2-(trifluoromethyl)phenyl]methanone, with the CAS number 898782-05-3, is characterized by its complex molecular structure, which includes a thiomorpholine moiety and a trifluoromethyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility characteristics. The presence of the trifluoromethyl group often enhances lipophilicity and can influence the compound's biological activity, making it of interest in medicinal chemistry. Additionally, the thiomorpholine ring may impart unique steric and electronic properties, affecting how the molecule interacts with biological targets. The compound's stability, solubility, and reactivity can vary based on environmental conditions such as pH and temperature. Overall, this substance may have applications in pharmaceutical development, particularly in the design of novel therapeutic agents. However, specific experimental data would be necessary to fully elucidate its physical and chemical properties.

Formula: C₁₉H₁₈F₃NOS

InChI: InChI=1/C19H18F3NOS/c20-19(21,22)17-8-4-3-7-16(17)18(24)15-6-2-1-5-14(15)13-23-9-11-25-12-10-23/h1-8H,9-13H2

SMILES: c1ccc(c(c1)CN1CCSCC1)C(=O)c1ccccc1C(F)(F)F

2-thiomorpholinomethyl-2′-trifluoromethylbenzophenone

CAS: 898782-05-3

Formula: C₁₉H₁₈F₃NOS

Purity: 97.0%

Molecular weight: 365.41

Ref: 10-F205426