CymitQuimica logo

CAS 898782-16-6

:

ethyl 8-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)phenyl]-8-oxo-octanoate

Description:
Ethyl 8-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)phenyl]-8-oxo-octanoate, identified by its CAS number 898782-16-6, is a synthetic organic compound characterized by its complex molecular structure, which includes an ester functional group and a spirocyclic moiety. The presence of the ethyl ester indicates that it can participate in various chemical reactions typical of esters, such as hydrolysis and transesterification. The compound features a phenyl ring substituted with a spirocyclic structure that contains both nitrogen and oxygen atoms, suggesting potential biological activity and interactions. Its octanoate chain contributes to its lipophilicity, which may influence its solubility and permeability in biological systems. The unique combination of functional groups and structural features may render it of interest in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C24H35NO5
InChI:InChI=1/C24H35NO5/c1-2-28-23(27)8-6-4-3-5-7-22(26)21-11-9-20(10-12-21)19-25-15-13-24(14-16-25)29-17-18-30-24/h9-12H,2-8,13-19H2,1H3
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.