CAS 898782-20-2

Methanone, (3-chloro-5-fluorophenyl)[2-(4-thiomorpholinylmethyl)phenyl]-

Description:

Methanone, (3-chloro-5-fluorophenyl)[2-(4-thiomorpholinylmethyl)phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of chlorine and fluorine substituents on the phenyl rings contributes to its unique reactivity and potential biological activity. The thiomorpholine moiety introduces a sulfur atom into the structure, which can enhance solubility and influence pharmacokinetic properties. This compound may exhibit interesting properties in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. Its molecular structure suggests potential applications in areas such as drug design, where modifications to the aromatic rings and substituents can lead to variations in activity and selectivity. As with many synthetic organic compounds, understanding its stability, solubility, and reactivity under various conditions is crucial for its practical applications. Safety and handling considerations should also be taken into account, given the presence of halogenated groups.

Formula: C₁₈H₁₇ClFNOS

InChI: InChI=1/C18H17ClFNOS/c19-15-9-14(10-16(20)11-15)18(22)17-4-2-1-3-13(17)12-21-5-7-23-8-6-21/h1-4,9-11H,5-8,12H2

InChI key: InChIKey=HFZFZVAGOJCQCM-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(CN2CCSCC2)C=CC=C1)C3=CC(Cl)=CC(F)=C3

Synonyms:

• (3-Chloro-5-fluorophenyl)[2-(4-thiomorpholinylmethyl)phenyl]methanone
• Methanone, (3-chloro-5-fluorophenyl)[2-(4-thiomorpholinylmethyl)phenyl]-

3-chloro-5-fluoro-2′-thiomorpholinomethyl benzophenone

CAS: 898782-20-2

Formula: C₁₈H₁₇ClFNOS

Purity: 97.0%

Molecular weight: 349.85

Ref: 10-F205431