CAS 898782-22-4

Methanone, (2-methylphenyl)[4-(4-thiomorpholinylmethyl)phenyl]-

Description:

Methanone, (2-methylphenyl)[4-(4-thiomorpholinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a 2-methylphenyl group indicates that it has a methyl substituent on a phenyl ring, contributing to its hydrophobic characteristics. The compound also features a thiomorpholine moiety, which introduces a sulfur atom into the structure, enhancing its potential for biological activity and interaction with various biological targets. This compound is likely to exhibit moderate to high lipophilicity due to its aromatic components, which can influence its solubility and permeability in biological systems. Additionally, the presence of multiple functional groups may allow for diverse reactivity and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Overall, the unique combination of structural elements in this compound suggests it may possess interesting chemical and biological properties, warranting further investigation.

Formula: C₁₉H₂₁NOS

InChI: InChI=1S/C19H21NOS/c1-15-4-2-3-5-18(15)19(21)17-8-6-16(7-9-17)14-20-10-12-22-13-11-20/h2-9H,10-14H2,1H3

InChI key: InChIKey=YISMXVJEKUIPBF-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(CN2CCSCC2)C=C1)C3=C(C)C=CC=C3

Synonyms:

• (2-Methylphenyl)[4-(4-thiomorpholinylmethyl)phenyl]methanone
• Methanone, (2-methylphenyl)[4-(4-thiomorpholinylmethyl)phenyl]-
• 2-Methyl-4′-thiomorpholinomethyl benzophenone

2-methyl-4′-thiomorpholinomethyl benzophenone

CAS: 898782-22-4

Formula: C₁₉H₂₁NOS

Purity: 97.0%

Molecular weight: 311.44

Ref: 10-F204485