CymitQuimica logo

CAS 898782-26-8

:

Methanone, (2,3-dichlorophenyl)[2-(4-thiomorpholinylmethyl)phenyl]-

Description:
Methanone, (2,3-dichlorophenyl)[2-(4-thiomorpholinylmethyl)phenyl]- is a synthetic organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of dichlorophenyl and thiomorpholinylmethyl substituents contributes to its unique chemical properties, including potential biological activity. This compound is likely to exhibit moderate to high lipophilicity due to its aromatic components, which can influence its solubility and permeability in biological systems. The thiomorpholine moiety may impart specific pharmacological properties, making it of interest in medicinal chemistry. Additionally, the chlorinated aromatic ring can enhance the compound's reactivity and stability under certain conditions. As with many synthetic compounds, safety and handling precautions are essential, as it may pose risks such as toxicity or environmental hazards. Overall, this compound's intricate structure suggests potential applications in pharmaceuticals or agrochemicals, warranting further investigation into its biological effects and mechanisms of action.
Formula:C18H17Cl2NOS
InChI:InChI=1S/C18H17Cl2NOS/c19-16-7-3-6-15(17(16)20)18(22)14-5-2-1-4-13(14)12-21-8-10-23-11-9-21/h1-7H,8-12H2
InChI key:InChIKey=JKQQTBIWNAFLBT-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(CN2CCSCC2)C=CC=C1)C3=C(Cl)C(Cl)=CC=C3
Synonyms:
  • Methanone, (2,3-dichlorophenyl)[2-(4-thiomorpholinylmethyl)phenyl]-
  • 2,3-Dichloro-2′-thiomorpholinomethyl benzophenone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.