CAS 898782-27-9

1-Propanone, 3-(3-bromophenyl)-1-[2-(methylthio)phenyl]-

Description:

1-Propanone, 3-(3-bromophenyl)-1-[2-(methylthio)phenyl]- is an organic compound characterized by its ketone functional group, which is indicated by the "propanone" part of its name. This compound features a propanone backbone with two distinct aromatic substituents: a 3-bromophenyl group and a 2-(methylthio)phenyl group. The presence of the bromine atom introduces notable electrophilic properties, while the methylthio group can influence the compound's reactivity and solubility. The molecular structure suggests potential applications in organic synthesis and medicinal chemistry, particularly due to the presence of the bromine and sulfur functionalities, which can participate in various chemical reactions. Additionally, the compound's properties, such as boiling point, melting point, and solubility, would be influenced by the steric and electronic effects of the substituents. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of halogenated and sulfur-containing groups, which may pose environmental and health risks.

Formula: C₁₆H₁₅BrOS

InChI: InChI=1S/C16H15BrOS/c1-19-16-8-3-2-7-14(16)15(18)10-9-12-5-4-6-13(17)11-12/h2-8,11H,9-10H2,1H3

InChI key: InChIKey=WCLFIAUKIXMXEE-UHFFFAOYSA-N

SMILES: C(CCC1=CC(Br)=CC=C1)(=O)C2=C(SC)C=CC=C2

Synonyms:

• 3-(3-Bromophenyl)-1-(2-methylsulfanylphenyl)propan-1-one
• 1-Propanone, 3-(3-bromophenyl)-1-[2-(methylthio)phenyl]-

3-(3-bromophenyl)-2′-thiomethylpropiophenone

CAS: 898782-27-9

Formula: C₁₆H₁₅BrOS

Purity: 97.0%

Molecular weight: 335.26

Ref: 10-F206054