CAS 898782-28-0
:Methanone, (4-methylphenyl)[4-(4-thiomorpholinylmethyl)phenyl]-
Description:
Methanone, (4-methylphenyl)[4-(4-thiomorpholinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a ketone functional group and multiple aromatic rings. The presence of the 4-methylphenyl group indicates that it has a methyl substituent on one of the phenyl rings, enhancing its hydrophobic characteristics. The compound also features a thiomorpholine moiety, which introduces a sulfur atom into the structure, potentially influencing its reactivity and solubility. This compound may exhibit interesting biological activities due to its unique functional groups, making it a candidate for research in medicinal chemistry. Its molecular interactions could be significant in drug design, particularly in targeting specific biological pathways. The presence of both aromatic and heterocyclic components suggests potential for diverse applications, including in pharmaceuticals or as a building block in organic synthesis. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C19H21NOS
InChI:InChI=1S/C19H21NOS/c1-15-2-6-17(7-3-15)19(21)18-8-4-16(5-9-18)14-20-10-12-22-13-11-20/h2-9H,10-14H2,1H3
InChI key:InChIKey=IHGCJZZOIOYLLY-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC=C(CN2CCSCC2)C=C1)C3=CC=C(C)C=C3
Synonyms:- Methanone, (4-methylphenyl)[4-(4-thiomorpholinylmethyl)phenyl]-
- 4-Methyl-4′-thiomorpholinomethyl benzophenone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.