CAS 898782-31-5
:Methanone, (2-methoxyphenyl)[4-(4-thiomorpholinylmethyl)phenyl]-
Description:
Methanone, (2-methoxyphenyl)[4-(4-thiomorpholinylmethyl)phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a methoxy group (–OCH3) on one of the phenyl rings enhances its solubility and reactivity. The compound also features a thiomorpholine moiety, which introduces a sulfur atom into the structure, potentially affecting its biological activity and interaction with other molecules. This compound may exhibit properties typical of both ketones and aromatic compounds, such as stability under certain conditions and the ability to participate in electrophilic aromatic substitution reactions. Its specific applications and biological activities would depend on the context of its use, particularly in medicinal chemistry or material science. As with many organic compounds, safety and handling precautions should be observed, especially considering the presence of sulfur and nitrogen in its structure, which may influence its toxicity and environmental impact.
Formula:C19H21NO2S
InChI:InChI=1S/C19H21NO2S/c1-22-18-5-3-2-4-17(18)19(21)16-8-6-15(7-9-16)14-20-10-12-23-13-11-20/h2-9H,10-14H2,1H3
InChI key:InChIKey=NJHJTXBJHUZCJG-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(OC)C=CC=C1)C2=CC=C(CN3CCSCC3)C=C2
Synonyms:- 2-Methoxy-4′-thiomorpholinomethyl benzophenone
- Methanone, (2-methoxyphenyl)[4-(4-thiomorpholinylmethyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.