CAS 898782-35-9

Methanone, (3,4-dichlorophenyl)[2-(4-thiomorpholinylmethyl)phenyl]-

Description:

Methanone, (3,4-dichlorophenyl)[2-(4-thiomorpholinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of the 3,4-dichlorophenyl group indicates that the compound has chlorine substituents on the aromatic ring, which can influence its reactivity and biological activity. The thiomorpholine moiety suggests that the compound may exhibit unique properties due to the sulfur atom in the ring, potentially affecting its solubility and interaction with biological systems. This compound is likely to be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that may confer specific biological activities. Additionally, the presence of multiple functional groups can lead to diverse chemical reactivity, making it a candidate for further research in synthetic applications or as a lead compound in drug discovery. As with many organic compounds, its stability, solubility, and reactivity will depend on environmental conditions and the presence of other chemical species.

Formula: C₁₈H₁₇Cl₂NOS

InChI: InChI=1S/C18H17Cl2NOS/c19-16-6-5-13(11-17(16)20)18(22)15-4-2-1-3-14(15)12-21-7-9-23-10-8-21/h1-6,11H,7-10,12H2

InChI key: InChIKey=KKTNOVUDJXSWPJ-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(CN2CCSCC2)C=CC=C1)C3=CC(Cl)=C(Cl)C=C3

Synonyms:

• Methanone, (3,4-dichlorophenyl)[2-(4-thiomorpholinylmethyl)phenyl]-
• (3,4-Dichlorophenyl)[2-(4-thiomorpholinylmethyl)phenyl]methanone
• 3,4-Dichloro-2′-thiomorpholinomethyl benzophenone