CAS 898782-37-1

(4-methoxyphenyl)-[4-(thiomorpholinomethyl)phenyl]methanone

Description:

The chemical substance known as (4-methoxyphenyl)-[4-(thiomorpholinomethyl)phenyl]methanone, with the CAS number 898782-37-1, is a synthetic organic compound characterized by its complex molecular structure. It features a ketone functional group, which is indicative of its potential reactivity and applications in organic synthesis. The presence of a methoxy group (-OCH3) on one of the phenyl rings enhances its solubility in organic solvents and may influence its electronic properties, making it a candidate for various chemical reactions. Additionally, the thiomorpholine moiety introduces a sulfur atom into the structure, which can impart unique properties such as increased nucleophilicity and potential biological activity. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with biological targets. Overall, its characteristics suggest versatility in chemical reactivity and potential applications in drug discovery and development.

Formula: C₁₉H₂₁NO₂S

InChI: InChI=1/C19H21NO2S/c1-22-18-8-6-17(7-9-18)19(21)16-4-2-15(3-5-16)14-20-10-12-23-13-11-20/h2-9H,10-14H2,1H3

SMILES: COc1ccc(cc1)C(=O)c1ccc(cc1)CN1CCSCC1

4-methoxy-4′-thiomorpholinomethyl benzophenone

CAS: 898782-37-1

Formula: C₁₉H₂₁NO₂S

Purity: 97.0%

Molecular weight: 327.44

Ref: 10-F204490