CAS 898782-38-2

Methanone, (3,5-dichlorophenyl)[2-(4-thiomorpholinylmethyl)phenyl]-

Description:

Methanone, (3,5-dichlorophenyl)[2-(4-thiomorpholinylmethyl)phenyl]- is a synthetic organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of the 3,5-dichlorophenyl group indicates that the compound has two chlorine substituents on the phenyl ring, which can influence its reactivity and biological activity. The thiomorpholine moiety suggests that the compound may exhibit unique properties due to the sulfur atom in the ring, potentially affecting its solubility and interaction with biological targets. This compound is likely to be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that may confer specific pharmacological effects. Additionally, the presence of multiple functional groups may allow for various chemical reactions, making it a versatile compound in synthetic applications. As with many synthetic organic compounds, safety and handling precautions should be observed, given the potential toxicity associated with halogenated and sulfur-containing compounds.

Formula: C₁₈H₁₇Cl₂NOS

InChI: InChI=1S/C18H17Cl2NOS/c19-15-9-14(10-16(20)11-15)18(22)17-4-2-1-3-13(17)12-21-5-7-23-8-6-21/h1-4,9-11H,5-8,12H2

InChI key: InChIKey=WKGNLHUYZKPFNL-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(CN2CCSCC2)C=CC=C1)C3=CC(Cl)=CC(Cl)=C3

Synonyms:

• Methanone, (3,5-dichlorophenyl)[2-(4-thiomorpholinylmethyl)phenyl]-
• 3,5-Dichloro-2′-thiomorpholinomethyl benzophenone

3,5-dichloro-2′-thiomorpholinomethyl benzophenone

CAS: 898782-38-2

Formula: C₁₈H₁₇Cl₂NOS

Purity: 97.0%

Molecular weight: 366.3

Ref: 10-F205437