CAS 898782-41-7
:(2,4-difluorophenyl)-[2-(thiomorpholinomethyl)phenyl]methanone
Description:
(2,4-Difluorophenyl)-[2-(thiomorpholinomethyl)phenyl]methanone, with CAS number 898782-41-7, is a synthetic organic compound characterized by its complex structure, which includes a difluorophenyl group and a thiomorpholinomethyl substituent. This compound typically exhibits properties associated with both aromatic and heterocyclic systems, contributing to its potential biological activity. The presence of fluorine atoms can enhance lipophilicity and metabolic stability, while the thiomorpholine moiety may impart unique pharmacological properties. As a ketone, it features a carbonyl group, which can participate in various chemical reactions, including nucleophilic additions. The compound's molecular interactions may be influenced by its ability to form hydrogen bonds and engage in π-π stacking due to its aromatic rings. Such characteristics make it of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. However, detailed studies on its biological activity, toxicity, and environmental impact would be necessary to fully understand its applications and safety profile.
Formula:C18H17F2NOS
InChI:InChI=1/C18H17F2NOS/c19-14-5-6-16(17(20)11-14)18(22)15-4-2-1-3-13(15)12-21-7-9-23-10-8-21/h1-6,11H,7-10,12H2
SMILES:c1ccc(c(c1)CN1CCSCC1)C(=O)c1ccc(cc1F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.