CAS 898782-43-9

3-[4-(thiomorpholinomethyl)benzoyl]benzonitrile

Description:

3-[4-(Thiomorpholinomethyl)benzoyl]benzonitrile, with the CAS number 898782-43-9, is a chemical compound characterized by its complex structure that includes a benzoyl group and a thiomorpholine moiety. This compound typically exhibits properties such as moderate solubility in organic solvents, which is common for compounds containing aromatic rings and heterocycles. The presence of the thiomorpholine group may impart specific biological activities, making it of interest in pharmaceutical research. The compound's molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the nitrile functional group may contribute to its reactivity and stability under various conditions. Overall, the characteristics of this compound make it a subject of interest in medicinal chemistry and related fields, where its unique structural features could lead to the development of novel therapeutic agents.

Formula: C₁₉H₁₈N₂OS

InChI: InChI=1/C19H18N2OS/c20-13-16-2-1-3-18(12-16)19(22)17-6-4-15(5-7-17)14-21-8-10-23-11-9-21/h1-7,12H,8-11,14H2

SMILES: c1cc(cc(c1)C(=O)c1ccc(cc1)CN1CCSCC1)C#N