CAS 898782-46-2

4-[4-(thiomorpholinomethyl)benzoyl]benzonitrile

Description:

4-[4-(Thiomorpholinomethyl)benzoyl]benzonitrile, with the CAS number 898782-46-2, is a synthetic organic compound characterized by its complex molecular structure, which includes a benzoyl group and a thiomorpholine moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the thiomorpholine ring suggests that it may interact with biological targets, possibly influencing its pharmacological profile. Its nitrile functional group can also contribute to its reactivity and stability under various conditions. The compound's structural features may allow for specific interactions with proteins or enzymes, which is a key consideration in drug design. Overall, 4-[4-(thiomorpholinomethyl)benzoyl]benzonitrile represents a class of compounds that may have applications in medicinal chemistry, particularly in the development of new therapeutic agents. Further studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₁₉H₁₈N₂OS

InChI: InChI=1/C19H18N2OS/c20-13-15-1-5-17(6-2-15)19(22)18-7-3-16(4-8-18)14-21-9-11-23-12-10-21/h1-8H,9-12,14H2

SMILES: c1cc(ccc1C#N)C(=O)c1ccc(cc1)CN1CCSCC1

4-cyano-4′-thiomorpholinomethyl benzophenone

CAS: 898782-46-2

Formula: C₁₉H₁₈N₂OS

Purity: 97.0%

Molecular weight: 322.43

Ref: 10-F204493