CAS 898782-47-3

Methanone, (3,5-difluorophenyl)[2-(4-thiomorpholinylmethyl)phenyl]-

Description:

Methanone, (3,5-difluorophenyl)[2-(4-thiomorpholinylmethyl)phenyl]- is a synthetic organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of fluorine atoms at the 3 and 5 positions of the phenyl ring contributes to its electronic properties, potentially enhancing its reactivity and influencing its interactions with biological targets. The thiomorpholine moiety introduces a sulfur atom into the structure, which can affect solubility and biological activity. This compound is likely to exhibit specific pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its unique combination of functional groups may also impart distinctive physical properties, such as melting point and solubility in various solvents. As with many synthetic compounds, its safety and environmental impact would need to be assessed through appropriate studies. Overall, this compound exemplifies the complexity and diversity of organic molecules used in research and drug development.

Formula: C₁₈H₁₇F₂NOS

InChI: InChI=1S/C18H17F2NOS/c19-15-9-14(10-16(20)11-15)18(22)17-4-2-1-3-13(17)12-21-5-7-23-8-6-21/h1-4,9-11H,5-8,12H2

InChI key: InChIKey=DBGFEFOAQBYPNW-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(CN2CCSCC2)C=CC=C1)C3=CC(F)=CC(F)=C3

Synonyms:

• Methanone, (3,5-difluorophenyl)[2-(4-thiomorpholinylmethyl)phenyl]-
• (3,5-Difluorophenyl)[2-(4-thiomorpholinylmethyl)phenyl]methanone

3,5-difluoro-2′-thiomorpholinomethyl benzophenone

CAS: 898782-47-3

Formula: C₁₈H₁₇F₂NOS

Purity: 97.0%

Molecular weight: 333.4

Ref: 10-F205440