CymitQuimica logo

CAS 898782-49-5

:

ethyl 2-[4-(thiomorpholinomethyl)benzoyl]benzoate

Description:
Ethyl 2-[4-(thiomorpholinomethyl)benzoyl]benzoate, identified by its CAS number 898782-49-5, is a synthetic organic compound characterized by its complex structure, which includes an ethyl ester group, a benzoyl moiety, and a thiomorpholine substituent. This compound typically exhibits properties associated with esters, such as being a colorless to pale yellow liquid or solid, depending on its specific formulation and purity. It is likely to be soluble in organic solvents, while its solubility in water may be limited due to the presence of hydrophobic aromatic rings. The thiomorpholine group introduces potential for biological activity, making this compound of interest in medicinal chemistry and drug development. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. As with many organic compounds, handling should be done with care, considering safety data sheets for toxicity and reactivity information. Overall, ethyl 2-[4-(thiomorpholinomethyl)benzoyl]benzoate represents a versatile compound with potential applications in various fields, including pharmaceuticals and materials science.
Formula:C21H23NO3S
InChI:InChI=1S/C21H23NO3S/c1-2-25-21(24)19-6-4-3-5-18(19)20(23)17-9-7-16(8-10-17)15-22-11-13-26-14-12-22/h3-10H,2,11-15H2,1H3
InChI key:InChIKey=WZBXHPUVVQVIBG-UHFFFAOYSA-N
SMILES:CCOC(=O)c1ccccc1C(=O)c1ccc(cc1)CN1CCSCC1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.