CAS 898782-50-8

Methanone, [2-(4-thiomorpholinylmethyl)phenyl](3,4,5-trifluorophenyl)-

Description:

Methanone, [2-(4-thiomorpholinylmethyl)phenyl](3,4,5-trifluorophenyl)-, also known by its CAS number 898782-50-8, is an organic compound characterized by its complex structure that includes a methanone functional group, a thiomorpholine moiety, and a trifluorophenyl group. The presence of the thiomorpholine ring suggests potential for interactions with biological systems, as this heterocyclic structure can influence the compound's pharmacological properties. The trifluorophenyl group enhances lipophilicity and may contribute to the compound's stability and reactivity. This compound is likely to exhibit unique chemical behavior due to the electron-withdrawing nature of the trifluoromethyl groups, which can affect its reactivity and interaction with other molecules. Additionally, the presence of multiple functional groups may allow for diverse applications in medicinal chemistry, particularly in the development of pharmaceuticals. Overall, the characteristics of this compound make it a subject of interest for further research in various chemical and biological contexts.

Formula: C₁₈H₁₆F₃NOS

InChI: InChI=1S/C18H16F3NOS/c19-15-9-13(10-16(20)17(15)21)18(23)14-4-2-1-3-12(14)11-22-5-7-24-8-6-22/h1-4,9-10H,5-8,11H2

InChI key: InChIKey=KADSAPTVHTWSMO-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(CN2CCSCC2)C=CC=C1)C3=CC(F)=C(F)C(F)=C3

Synonyms:

• Methanone, [2-(4-thiomorpholinylmethyl)phenyl](3,4,5-trifluorophenyl)-
• 2′-Thiomorpholinomethyl-3,4,5-trifluorobenzophenone

2′-thiomorpholinomethyl-3,4,5-trifluorobenzophenone

CAS: 898782-50-8

Formula: C₁₈H₁₆F₃NOS

Purity: 97.0%

Molecular weight: 351.39

Ref: 10-F205441